C13H19NO3S — CID 55063038
N-(2-ethylsulfonylethyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 55063038) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-(2-ethylsulfonylethyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 55063038 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCS(=O)(=O)CCNC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H19NO3S/c1-2-18(15,16)10-8-14-12-7-9-17-13-6-4-3-5-11(12)13/h3-6,12,14H,2,7-10H2,1H3 |
| InChIKey | ZNOUQUMSDVCFQP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |