C13H19NO2 — CID 62365912
1-(3,4-dihydro-2H-chromen-4-ylamino)butan-2-ol (PubChem CID 62365912) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-ylamino)butan-2-ol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-ylamino)butan-2-ol |
|---|---|
| PubChem CID | 62365912 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-ylamino)butan-2-ol |
| SMILES | CCC(O)CNC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H19NO2/c1-2-10(15)9-14-12-7-8-16-13-6-4-3-5-11(12)13/h3-6,10,12,14-15H,2,7-9H2,1H3 |
| InChIKey | BIAHYKVMACWZPG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |