C12H16N2O3 — CID 106171125
3-(3,4-dihydro-2H-chromen-4-ylamino)-2-hydroxypropanamide (PubChem CID 106171125) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-ylamino)-2-hydroxypropanamide.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-ylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106171125 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-ylamino)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC1CCOc2ccccc21 |
| InChI | InChI=1S/C12H16N2O3/c13-12(16)10(15)7-14-9-5-6-17-11-4-2-1-3-8(9)11/h1-4,9-10,14-15H,5-7H2,(H2,13,16) |
| InChIKey | NDYIRDVPDQKLES-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |