C12H16N2O3 — CID 97083391
1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(2-hydroxyethyl)urea (PubChem CID 97083391) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 97083391 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)N[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C12H16N2O3/c15-7-6-13-12(16)14-10-5-8-17-11-4-2-1-3-9(10)11/h1-4,10,15H,5-8H2,(H2,13,14,16)/t10-/m0/s1 |
| InChIKey | HRLSWTGDBRKSBY-JTQLQIEISA-N |
| XLogP | 0.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |