C18H18N2O4 — CID 53498052
1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea (PubChem CID 53498052) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea |
|---|---|
| PubChem CID | 53498052 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dihydro-2H-chromen-4-yl)urea |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H18N2O4/c21-18(19-10-12-5-6-16-17(9-12)24-11-23-16)20-14-7-8-22-15-4-2-1-3-13(14)15/h1-6,9,14H,7-8,10-11H2,(H2,19,20,21) |
| InChIKey | WCHSQOWSVXVAPS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |