C17H17FN2O2 — CID 110750884
1-benzyl-3-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)urea (PubChem CID 110750884) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 1-benzyl-3-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)urea.
| Compound Name | 1-benzyl-3-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)urea |
|---|---|
| PubChem CID | 110750884 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-benzyl-3-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)urea |
| SMILES | O=C(NCc1ccccc1)NC1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C17H17FN2O2/c18-13-6-7-16-14(10-13)15(8-9-22-16)20-17(21)19-11-12-4-2-1-3-5-12/h1-7,10,15H,8-9,11H2,(H2,19,20,21) |
| InChIKey | LLJCZFKYYGMIGL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |