C16H20FNO2 — CID 110751256
N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)cyclohexanecarboxamide (PubChem CID 110751256) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)cyclohexanecarboxamide.
| Compound Name | N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110751256 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)cyclohexanecarboxamide |
| SMILES | O=C(NC1CCOc2ccc(F)cc21)C1CCCCC1 |
| InChI | InChI=1S/C16H20FNO2/c17-12-6-7-15-13(10-12)14(8-9-20-15)18-16(19)11-4-2-1-3-5-11/h6-7,10-11,14H,1-5,8-9H2,(H,18,19) |
| InChIKey | VLAXWYUYLDWPCL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |