C17H23FN2OS — CID 71887422
1-cyclohexyl-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)thiourea (PubChem CID 71887422) has the molecular formula C17H23FN2OS and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)thiourea.
| Compound Name | 1-cyclohexyl-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)thiourea |
|---|---|
| PubChem CID | 71887422 |
| Molecular Formula | C17H23FN2OS |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-cyclohexyl-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)thiourea |
| SMILES | Fc1ccc2c(c1)C(NC(=S)NC1CCCCC1)CCCO2 |
| InChI | InChI=1S/C17H23FN2OS/c18-12-8-9-16-14(11-12)15(7-4-10-21-16)20-17(22)19-13-5-2-1-3-6-13/h8-9,11,13,15H,1-7,10H2,(H2,19,20,22) |
| InChIKey | PRIJJTBYBBGPRR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|