C14H16FNO2 — CID 110477991
(E)-N-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)but-2-enamide (PubChem CID 110477991) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is (E)-N-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)but-2-enamide.
| Compound Name | (E)-N-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)but-2-enamide |
|---|---|
| PubChem CID | 110477991 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (E)-N-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)NC1CCCOc2ccc(F)cc21 |
| InChI | InChI=1S/C14H16FNO2/c1-2-4-14(17)16-12-5-3-8-18-13-7-6-10(15)9-11(12)13/h2,4,6-7,9,12H,3,5,8H2,1H3,(H,16,17)/b4-2+ |
| InChIKey | UXZXGFHGRUJKEK-DUXPYHPUSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|