C15H15ClFN5O2 — CID 56798680
1-[(6-chloropyridazin-3-yl)amino]-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea (PubChem CID 56798680) has the molecular formula C15H15ClFN5O2 and a molecular weight of 351.77 g/mol. Its IUPAC name is 1-[(6-chloropyridazin-3-yl)amino]-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea.
| Compound Name | 1-[(6-chloropyridazin-3-yl)amino]-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea |
|---|---|
| PubChem CID | 56798680 |
| Molecular Formula | C15H15ClFN5O2 |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-[(6-chloropyridazin-3-yl)amino]-3-(7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea |
| SMILES | O=C(NNc1ccc(Cl)nn1)NC1CCCOc2ccc(F)cc21 |
| InChI | InChI=1S/C15H15ClFN5O2/c16-13-5-6-14(20-19-13)21-22-15(23)18-11-2-1-7-24-12-4-3-9(17)8-10(11)12/h3-6,8,11H,1-2,7H2,(H,20,21)(H2,18,22,23) |
| InChIKey | GKOIQUCOTFTPFR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|