C13H16N2O4 — CID 115755744
1-(1,3-benzodioxol-5-ylmethyl)-3-(oxolan-3-yl)urea (PubChem CID 115755744) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(oxolan-3-yl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 115755744 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(oxolan-3-yl)urea |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)NC1CCOC1 |
| InChI | InChI=1S/C13H16N2O4/c16-13(15-10-3-4-17-7-10)14-6-9-1-2-11-12(5-9)19-8-18-11/h1-2,5,10H,3-4,6-8H2,(H2,14,15,16) |
| InChIKey | LWOKDEKXORYQHE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |