C12H16N2O3 — CID 115759359
1-[(2-hydroxyphenyl)methyl]-3-(oxolan-3-yl)urea (PubChem CID 115759359) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)methyl]-3-(oxolan-3-yl)urea.
| Compound Name | 1-[(2-hydroxyphenyl)methyl]-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 115759359 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-3-(oxolan-3-yl)urea |
| SMILES | O=C(NCc1ccccc1O)NC1CCOC1 |
| InChI | InChI=1S/C12H16N2O3/c15-11-4-2-1-3-9(11)7-13-12(16)14-10-5-6-17-8-10/h1-4,10,15H,5-8H2,(H2,13,14,16) |
| InChIKey | ARTIQPKTHPTBCG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|