C17H23N3O4 — CID 124611037
1-[(2-nitrophenyl)methyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea (PubChem CID 124611037) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-[(2-nitrophenyl)methyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea.
| Compound Name | 1-[(2-nitrophenyl)methyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
|---|---|
| PubChem CID | 124611037 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-[(2-nitrophenyl)methyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
| SMILES | O=C(NCc1ccccc1[N+](=O)[O-])N[C@H]1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H23N3O4/c21-16(18-12-13-5-1-2-6-15(13)20(22)23)19-14-7-10-24-17(11-14)8-3-4-9-17/h1-2,5-6,14H,3-4,7-12H2,(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | UFIIEWNDGQJVKY-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|