C16H21N3O5 — CID 133378052
N-(2,4-dinitrophenyl)-1-oxaspiro[5.5]undecan-4-amine (PubChem CID 133378052) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-1-oxaspiro[5.5]undecan-4-amine.
| Compound Name | N-(2,4-dinitrophenyl)-1-oxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 133378052 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(2,4-dinitrophenyl)-1-oxaspiro[5.5]undecan-4-amine |
| SMILES | O=[N+]([O-])c1ccc(NC2CCOC3(CCCCC3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O5/c20-18(21)13-4-5-14(15(10-13)19(22)23)17-12-6-9-24-16(11-12)7-2-1-3-8-16/h4-5,10,12,17H,1-3,6-9,11H2 |
| InChIKey | USQHKTVQLSFERF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|