C18H18N6O8 — CID 155539944
1-N,3-N-bis(2,4-dinitrophenyl)cyclohexane-1,3-diamine (PubChem CID 155539944) has the molecular formula C18H18N6O8 and a molecular weight of 446.38 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dinitrophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N,3-N-bis(2,4-dinitrophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 155539944 |
| Molecular Formula | C18H18N6O8 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1-N,3-N-bis(2,4-dinitrophenyl)cyclohexane-1,3-diamine |
| SMILES | O=[N+]([O-])c1ccc(NC2CCCC(Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N6O8/c25-21(26)13-4-6-15(17(9-13)23(29)30)19-11-2-1-3-12(8-11)20-16-7-5-14(22(27)28)10-18(16)24(31)32/h4-7,9-12,19-20H,1-3,8H2 |
| InChIKey | XVXNHWFEOPSZPM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 196.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|