C13H16N4O5 — CID 17066729
2-(cyclopentylamino)-N-(2,4-dinitrophenyl)acetamide (PubChem CID 17066729) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-(cyclopentylamino)-N-(2,4-dinitrophenyl)acetamide.
| Compound Name | 2-(cyclopentylamino)-N-(2,4-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 17066729 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-(cyclopentylamino)-N-(2,4-dinitrophenyl)acetamide |
| SMILES | O=C(CNC1CCCC1)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O5/c18-13(8-14-9-3-1-2-4-9)15-11-6-5-10(16(19)20)7-12(11)17(21)22/h5-7,9,14H,1-4,8H2,(H,15,18) |
| InChIKey | SLMSUWYQDZENQV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|