C11H13N3O4 — CID 107744629
2-(cyclopropylamino)-N-(2-hydroxy-5-nitrophenyl)acetamide (PubChem CID 107744629) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-(2-hydroxy-5-nitrophenyl)acetamide.
| Compound Name | 2-(cyclopropylamino)-N-(2-hydroxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 107744629 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-(cyclopropylamino)-N-(2-hydroxy-5-nitrophenyl)acetamide |
| SMILES | O=C(CNC1CC1)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C11H13N3O4/c15-10-4-3-8(14(17)18)5-9(10)13-11(16)6-12-7-1-2-7/h3-5,7,12,15H,1-2,6H2,(H,13,16) |
| InChIKey | VWZCFIOTRZSXMU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|