C11H12N2O4 — CID 113347528
2-cyclopropyl-N-(2-hydroxy-5-nitrophenyl)acetamide (PubChem CID 113347528) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2-hydroxy-5-nitrophenyl)acetamide.
| Compound Name | 2-cyclopropyl-N-(2-hydroxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 113347528 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-cyclopropyl-N-(2-hydroxy-5-nitrophenyl)acetamide |
| SMILES | O=C(CC1CC1)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C11H12N2O4/c14-10-4-3-8(13(16)17)6-9(10)12-11(15)5-7-1-2-7/h3-4,6-7,14H,1-2,5H2,(H,12,15) |
| InChIKey | FUSXQHCJFXBVPI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|