C12H16BrN3O2 — CID 79458199
1-N-(4-bromo-2-nitrophenyl)cyclohexane-1,3-diamine (PubChem CID 79458199) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is 1-N-(4-bromo-2-nitrophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(4-bromo-2-nitrophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79458199 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-N-(4-bromo-2-nitrophenyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(Nc2ccc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H16BrN3O2/c13-8-4-5-11(12(6-8)16(17)18)15-10-3-1-2-9(14)7-10/h4-6,9-10,15H,1-3,7,14H2 |
| InChIKey | NYPROXHBYNDNLC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|