C13H14BrF3N2O2 — CID 62896684
4-bromo-2-nitro-N-[4-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 62896684) has the molecular formula C13H14BrF3N2O2 and a molecular weight of 367.17 g/mol. Its IUPAC name is 4-bromo-2-nitro-N-[4-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 4-bromo-2-nitro-N-[4-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 62896684 |
| Molecular Formula | C13H14BrF3N2O2 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 4-bromo-2-nitro-N-[4-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H14BrF3N2O2/c14-9-3-6-11(12(7-9)19(20)21)18-10-4-1-8(2-5-10)13(15,16)17/h3,6-8,10,18H,1-2,4-5H2 |
| InChIKey | NMDIPZIRVUMJDR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|