C26H36Br2N4O4 — CID 159558435
4-(2-amino-4-bromoanilino)-1-methylcyclohexan-1-ol;4-(4-bromo-2-nitroanilino)-1-methylcyclohexan-1-ol (PubChem CID 159558435) has the molecular formula C26H36Br2N4O4 and a molecular weight of 628.41 g/mol. Its IUPAC name is 4-(2-amino-4-bromoanilino)-1-methylcyclohexan-1-ol;4-(4-bromo-2-nitroanilino)-1-methylcyclohexan-1-ol.
| Compound Name | 4-(2-amino-4-bromoanilino)-1-methylcyclohexan-1-ol;4-(4-bromo-2-nitroanilino)-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 159558435 |
| Molecular Formula | C26H36Br2N4O4 |
| Molecular Weight | 628.41 g/mol |
| Exact Mass | 626.11 |
| IUPAC Name | 4-(2-amino-4-bromoanilino)-1-methylcyclohexan-1-ol;4-(4-bromo-2-nitroanilino)-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Nc2ccc(Br)cc2N)CC1.CC1(O)CCC(Nc2ccc(Br)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H17BrN2O3.C13H19BrN2O/c1-13(17)6-4-10(5-7-13)15-11-3-2-9(14)8-12(11)16(18)19;1-13(17)6-4-10(5-7-13)16-12-3-2-9(14)8-11(12)15/h2-3,8,10,15,17H,4-7H2,1H3;2-3,8,10,16-17H,4-7,15H2,1H3 |
| InChIKey | MGHGZGKDIWDFAT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.41 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|