C14H21BrN2 — CID 65342799
4-bromo-2-N-(4,4-dimethylcyclohexyl)benzene-1,2-diamine (PubChem CID 65342799) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 4-bromo-2-N-(4,4-dimethylcyclohexyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(4,4-dimethylcyclohexyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65342799 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-bromo-2-N-(4,4-dimethylcyclohexyl)benzene-1,2-diamine |
| SMILES | CC1(C)CCC(Nc2cc(Br)ccc2N)CC1 |
| InChI | InChI=1S/C14H21BrN2/c1-14(2)7-5-11(6-8-14)17-13-9-10(15)3-4-12(13)16/h3-4,9,11,17H,5-8,16H2,1-2H3 |
| InChIKey | OJZSVBQLXAKJHC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|