C15H23BrN2 — CID 130201997
4-bromo-2-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine (PubChem CID 130201997) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 4-bromo-2-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 130201997 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-bromo-2-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine |
| SMILES | C[C@@H]1C[C@H](Nc2cc(Br)ccc2N)CC(C)(C)C1 |
| InChI | InChI=1S/C15H23BrN2/c1-10-6-12(9-15(2,3)8-10)18-14-7-11(16)4-5-13(14)17/h4-5,7,10,12,18H,6,8-9,17H2,1-3H3/t10-,12+/m1/s1 |
| InChIKey | JYJKDBGFNNZXDV-PWSUYJOCSA-N |
| XLogP | 4.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|