C16H23Br2N — CID 63425329
2,6-dibromo-4-methyl-N-(3,3,5-trimethylcyclohexyl)aniline (PubChem CID 63425329) has the molecular formula C16H23Br2N and a molecular weight of 389.18 g/mol. Its IUPAC name is 2,6-dibromo-4-methyl-N-(3,3,5-trimethylcyclohexyl)aniline.
| Compound Name | 2,6-dibromo-4-methyl-N-(3,3,5-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 63425329 |
| Molecular Formula | C16H23Br2N |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2,6-dibromo-4-methyl-N-(3,3,5-trimethylcyclohexyl)aniline |
| SMILES | Cc1cc(Br)c(NC2CC(C)CC(C)(C)C2)c(Br)c1 |
| InChI | InChI=1S/C16H23Br2N/c1-10-6-13(17)15(14(18)7-10)19-12-5-11(2)8-16(3,4)9-12/h6-7,11-12,19H,5,8-9H2,1-4H3 |
| InChIKey | APRUAPJHALOJLA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |