About 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline
2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline (PubChem CID 107598169) has the molecular formula C15H21BrFN
and a molecular weight of 314.24 g/mol. Its IUPAC name is 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline.
Molecular Properties
| Compound Name | 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
| PubChem CID | 107598169 |
| Molecular Formula | C15H21BrFN |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
| SMILES | CC1CC(Nc2c(F)cccc2Br)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21BrFN/c1-10-7-11(9-15(2,3)8-10)18-14-12(16)5-4-6-13(14)17/h4-6,10-11,18H,7-9H2,1-3H3 |
| InChIKey | QGTACGPNCVYVKF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
The IUPAC name of 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline (CID 107598169) is 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline.
What is the SMILES notation for 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
The canonical SMILES for 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline is CC1CC(Nc2c(F)cccc2Br)CC(C)(C)C1.
What is the InChIKey of 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
The InChIKey is QGTACGPNCVYVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrFN/c1-10-7-11(9-15(2,3)8-10)18-14-12(16)5-4-6-13(14)17/h4-6,10-11,18H,7-9H2,1-3H3.
What are the key properties of 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline has a molecular weight of 314.24 g/mol, XLogP of 5.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline is sourced from PubChem (CID 107598169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).