C15H21ClFN — CID 43721505
4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline (PubChem CID 43721505) has the molecular formula C15H21ClFN and a molecular weight of 269.79 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline.
| Compound Name | 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 43721505 |
| Molecular Formula | C15H21ClFN |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
| SMILES | CC1CC(Nc2ccc(Cl)c(F)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21ClFN/c1-10-6-12(9-15(2,3)8-10)18-11-4-5-13(16)14(17)7-11/h4-5,7,10,12,18H,6,8-9H2,1-3H3 |
| InChIKey | XZKGWBMACZDIKD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |