About 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline
4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline (PubChem CID 43721505) has the molecular formula C15H21ClFN
and a molecular weight of 269.79 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline.
Molecular Properties
| Compound Name | 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
| PubChem CID | 43721505 |
| Molecular Formula | C15H21ClFN |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline |
| SMILES | CC1CC(Nc2ccc(Cl)c(F)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21ClFN/c1-10-6-12(9-15(2,3)8-10)18-11-4-5-13(16)14(17)7-11/h4-5,7,10,12,18H,6,8-9H2,1-3H3 |
| InChIKey | XZKGWBMACZDIKD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
The IUPAC name of 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline (CID 43721505) is 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline.
What is the SMILES notation for 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
The canonical SMILES for 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline is CC1CC(Nc2ccc(Cl)c(F)c2)CC(C)(C)C1.
What is the InChIKey of 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
The InChIKey is XZKGWBMACZDIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClFN/c1-10-6-12(9-15(2,3)8-10)18-11-4-5-13(16)14(17)7-11/h4-5,7,10,12,18H,6,8-9H2,1-3H3.
What are the key properties of 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline?
4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline has a molecular weight of 269.79 g/mol, XLogP of 5.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-fluoro-N-(3,3,5-trimethylcyclohexyl)aniline is sourced from PubChem (CID 43721505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).