C17H25NO2 — CID 43097568
N-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43097568) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43097568 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC1CC(Nc2ccc3c(c2)OCCO3)CC(C)(C)C1 |
| InChI | InChI=1S/C17H25NO2/c1-12-8-14(11-17(2,3)10-12)18-13-4-5-15-16(9-13)20-7-6-19-15/h4-5,9,12,14,18H,6-8,10-11H2,1-3H3 |
| InChIKey | OAWQVADGYLQASB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|