C15H22N2O2 — CID 115145670
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5,5-dimethylpyrrolidin-3-amine (PubChem CID 115145670) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115145670 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1(C)CC(Nc2ccc3c(c2)OCCCO3)CN1 |
| InChI | InChI=1S/C15H22N2O2/c1-15(2)9-12(10-16-15)17-11-4-5-13-14(8-11)19-7-3-6-18-13/h4-5,8,12,16-17H,3,6-7,9-10H2,1-2H3 |
| InChIKey | RJOAWZNVTWHKNB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|