C12H16F2N2 — CID 115145681
N-(2,5-difluorophenyl)-5,5-dimethylpyrrolidin-3-amine (PubChem CID 115145681) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-5,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(2,5-difluorophenyl)-5,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115145681 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-(2,5-difluorophenyl)-5,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1(C)CC(Nc2cc(F)ccc2F)CN1 |
| InChI | InChI=1S/C12H16F2N2/c1-12(2)6-9(7-15-12)16-11-5-8(13)3-4-10(11)14/h3-5,9,15-16H,6-7H2,1-2H3 |
| InChIKey | XQVKBXJPNSMXNF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |