C11H17N3 — CID 115145743
N-(5,5-dimethylpyrrolidin-3-yl)pyridin-2-amine (PubChem CID 115145743) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-(5,5-dimethylpyrrolidin-3-yl)pyridin-2-amine.
| Compound Name | N-(5,5-dimethylpyrrolidin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 115145743 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-(5,5-dimethylpyrrolidin-3-yl)pyridin-2-amine |
| SMILES | CC1(C)CC(Nc2ccccn2)CN1 |
| InChI | InChI=1S/C11H17N3/c1-11(2)7-9(8-13-11)14-10-5-3-4-6-12-10/h3-6,9,13H,7-8H2,1-2H3,(H,12,14) |
| InChIKey | QESVLSNWGYJQHR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |