C9H13N3 — CID 19814840
N-pyrrolidin-3-ylpyridin-2-amine (PubChem CID 19814840) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is N-pyrrolidin-3-ylpyridin-2-amine.
| Compound Name | N-pyrrolidin-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 19814840 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N-pyrrolidin-3-ylpyridin-2-amine |
| SMILES | c1ccc(NC2CCNC2)nc1 |
| InChI | InChI=1S/C9H13N3/c1-2-5-11-9(3-1)12-8-4-6-10-7-8/h1-3,5,8,10H,4,6-7H2,(H,11,12) |
| InChIKey | HEMVTRSSBJCRGX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |