C10H13ClN4 — CID 71643662
2-(pyrrolidin-3-ylamino)pyridine-4-carbonitrile;hydrochloride (PubChem CID 71643662) has the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. Its IUPAC name is 2-(pyrrolidin-3-ylamino)pyridine-4-carbonitrile;hydrochloride.
| Compound Name | 2-(pyrrolidin-3-ylamino)pyridine-4-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 71643662 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-(pyrrolidin-3-ylamino)pyridine-4-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccnc(NC2CCNC2)c1 |
| InChI | InChI=1S/C10H12N4.ClH/c11-6-8-1-4-13-10(5-8)14-9-2-3-12-7-9;/h1,4-5,9,12H,2-3,7H2,(H,13,14);1H |
| InChIKey | XTWLXBQKLUATCC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |