C12H19N5 — CID 115264180
6-N-cyclobutyl-4-N-pyrrolidin-3-ylpyrimidine-4,6-diamine (PubChem CID 115264180) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 6-N-cyclobutyl-4-N-pyrrolidin-3-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-cyclobutyl-4-N-pyrrolidin-3-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115264180 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 6-N-cyclobutyl-4-N-pyrrolidin-3-ylpyrimidine-4,6-diamine |
| SMILES | c1nc(NC2CCC2)cc(NC2CCNC2)n1 |
| InChI | InChI=1S/C12H19N5/c1-2-9(3-1)16-11-6-12(15-8-14-11)17-10-4-5-13-7-10/h6,8-10,13H,1-5,7H2,(H2,14,15,16,17) |
| InChIKey | OKOUCINUQSFIPL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |