C14H23N5 — CID 115265252
N-cyclobutyl-6-(6-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine (PubChem CID 115265252) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-cyclobutyl-6-(6-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine.
| Compound Name | N-cyclobutyl-6-(6-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115265252 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-cyclobutyl-6-(6-methyl-1,4-diazepan-1-yl)pyrimidin-4-amine |
| SMILES | CC1CNCCN(c2cc(NC3CCC3)ncn2)C1 |
| InChI | InChI=1S/C14H23N5/c1-11-8-15-5-6-19(9-11)14-7-13(16-10-17-14)18-12-3-2-4-12/h7,10-12,15H,2-6,8-9H2,1H3,(H,16,17,18) |
| InChIKey | XMSUVZQRRLXBLF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |