C8H11ClN4 — CID 71639835
6-chloro-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine (PubChem CID 71639835) has the molecular formula C8H11ClN4 and a molecular weight of 198.66 g/mol. Its IUPAC name is 6-chloro-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71639835 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 6-chloro-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine |
| SMILES | Clc1cc(N[C@@H]2CCNC2)ncn1 |
| InChI | InChI=1S/C8H11ClN4/c9-7-3-8(12-5-11-7)13-6-1-2-10-4-6/h3,5-6,10H,1-2,4H2,(H,11,12,13)/t6-/m1/s1 |
| InChIKey | KIDBWQBDLKKHNU-ZCFIWIBFSA-N |
| XLogP | 0.90 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |