C10H15ClN4 — CID 86318064
6-chloro-N-[[(3S)-piperidin-3-yl]methyl]pyrimidin-4-amine (PubChem CID 86318064) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 6-chloro-N-[[(3S)-piperidin-3-yl]methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[[(3S)-piperidin-3-yl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 86318064 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 6-chloro-N-[[(3S)-piperidin-3-yl]methyl]pyrimidin-4-amine |
| SMILES | Clc1cc(NC[C@H]2CCCNC2)ncn1 |
| InChI | InChI=1S/C10H15ClN4/c11-9-4-10(15-7-14-9)13-6-8-2-1-3-12-5-8/h4,7-8,12H,1-3,5-6H2,(H,13,14,15)/t8-/m0/s1 |
| InChIKey | RVNXAMOKXRRDSR-QMMMGPOBSA-N |
| XLogP | 1.54 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |