C12H21ClN4O — CID 66569692
6-ethoxy-N-(piperidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride (PubChem CID 66569692) has the molecular formula C12H21ClN4O and a molecular weight of 272.78 g/mol. Its IUPAC name is 6-ethoxy-N-(piperidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride.
| Compound Name | 6-ethoxy-N-(piperidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 66569692 |
| Molecular Formula | C12H21ClN4O |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 6-ethoxy-N-(piperidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride |
| SMILES | CCOc1cc(NCC2CCCNC2)ncn1.Cl |
| InChI | InChI=1S/C12H20N4O.ClH/c1-2-17-12-6-11(15-9-16-12)14-8-10-4-3-5-13-7-10;/h6,9-10,13H,2-5,7-8H2,1H3,(H,14,15,16);1H |
| InChIKey | OWAVLPHEWPYZEW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |