C13H22N4O — CID 112634792
4-ethoxy-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine (PubChem CID 112634792) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-ethoxy-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-ethoxy-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112634792 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-ethoxy-6-methyl-N-(piperidin-3-ylmethyl)pyrimidin-2-amine |
| SMILES | CCOc1cc(C)nc(NCC2CCCNC2)n1 |
| InChI | InChI=1S/C13H22N4O/c1-3-18-12-7-10(2)16-13(17-12)15-9-11-5-4-6-14-8-11/h7,11,14H,3-6,8-9H2,1-2H3,(H,15,16,17) |
| InChIKey | FJCIVKPFDGCAFQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |