C10H15ClN4S — CID 97164952
6-chloro-2-methylsulfanyl-N-[[(3S)-pyrrolidin-3-yl]methyl]pyrimidin-4-amine (PubChem CID 97164952) has the molecular formula C10H15ClN4S and a molecular weight of 258.78 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-N-[[(3S)-pyrrolidin-3-yl]methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methylsulfanyl-N-[[(3S)-pyrrolidin-3-yl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 97164952 |
| Molecular Formula | C10H15ClN4S |
| Molecular Weight | 258.78 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-N-[[(3S)-pyrrolidin-3-yl]methyl]pyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NC[C@H]2CCNC2)n1 |
| InChI | InChI=1S/C10H15ClN4S/c1-16-10-14-8(11)4-9(15-10)13-6-7-2-3-12-5-7/h4,7,12H,2-3,5-6H2,1H3,(H,13,14,15)/t7-/m0/s1 |
| InChIKey | QEPWJRZRYXVMHH-ZETCQYMHSA-N |
| XLogP | 1.87 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.78 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |