C11H18N4 — CID 80563958
2,6-dimethyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 80563958) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2,6-dimethyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 2,6-dimethyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80563958 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2,6-dimethyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCC2CCNC2)nc(C)n1 |
| InChI | InChI=1S/C11H18N4/c1-8-5-11(15-9(2)14-8)13-7-10-3-4-12-6-10/h5,10,12H,3-4,6-7H2,1-2H3,(H,13,14,15) |
| InChIKey | SORAGUNTHPJBKK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |