C14H24N4 — CID 94076556
2-methyl-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine (PubChem CID 94076556) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-methyl-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-methyl-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 94076556 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-methyl-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine |
| SMILES | Cc1nc(NCC2CCNCC2)cc(C(C)C)n1 |
| InChI | InChI=1S/C14H24N4/c1-10(2)13-8-14(18-11(3)17-13)16-9-12-4-6-15-7-5-12/h8,10,12,15H,4-7,9H2,1-3H3,(H,16,17,18) |
| InChIKey | XRCMJGKSSDVLBG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |