C13H21ClN4 — CID 95928666
2-chloro-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine (PubChem CID 95928666) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-chloro-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 95928666 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-chloro-N-(piperidin-4-ylmethyl)-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1cc(NCC2CCNCC2)nc(Cl)n1 |
| InChI | InChI=1S/C13H21ClN4/c1-9(2)11-7-12(18-13(14)17-11)16-8-10-3-5-15-6-4-10/h7,9-10,15H,3-6,8H2,1-2H3,(H,16,17,18) |
| InChIKey | SKJURZCZTBOTPP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |