C10H16Cl2N4S — CID 71643194
6-chloro-2-methylsulfanyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride (PubChem CID 71643194) has the molecular formula C10H16Cl2N4S and a molecular weight of 295.24 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride.
| Compound Name | 6-chloro-2-methylsulfanyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 71643194 |
| Molecular Formula | C10H16Cl2N4S |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-N-(pyrrolidin-3-ylmethyl)pyrimidin-4-amine;hydrochloride |
| SMILES | CSc1nc(Cl)cc(NCC2CCNC2)n1.Cl |
| InChI | InChI=1S/C10H15ClN4S.ClH/c1-16-10-14-8(11)4-9(15-10)13-6-7-2-3-12-5-7;/h4,7,12H,2-3,5-6H2,1H3,(H,13,14,15);1H |
| InChIKey | GXRNKXAKSCZOBW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |