C11H17Cl2N3OS — CID 71643214
4-chloro-2-methylsulfanyl-6-(piperidin-3-ylmethoxy)pyrimidine;hydrochloride (PubChem CID 71643214) has the molecular formula C11H17Cl2N3OS and a molecular weight of 310.25 g/mol. Its IUPAC name is 4-chloro-2-methylsulfanyl-6-(piperidin-3-ylmethoxy)pyrimidine;hydrochloride.
| Compound Name | 4-chloro-2-methylsulfanyl-6-(piperidin-3-ylmethoxy)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 71643214 |
| Molecular Formula | C11H17Cl2N3OS |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 4-chloro-2-methylsulfanyl-6-(piperidin-3-ylmethoxy)pyrimidine;hydrochloride |
| SMILES | CSc1nc(Cl)cc(OCC2CCCNC2)n1.Cl |
| InChI | InChI=1S/C11H16ClN3OS.ClH/c1-17-11-14-9(12)5-10(15-11)16-7-8-3-2-4-13-6-8;/h5,8,13H,2-4,6-7H2,1H3;1H |
| InChIKey | ZJFUOHRPSNLTOD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |