C10H16ClN3OS — CID 71643354
2-methylsulfanyl-4-(pyrrolidin-3-ylmethoxy)pyrimidine;hydrochloride (PubChem CID 71643354) has the molecular formula C10H16ClN3OS and a molecular weight of 261.78 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(pyrrolidin-3-ylmethoxy)pyrimidine;hydrochloride.
| Compound Name | 2-methylsulfanyl-4-(pyrrolidin-3-ylmethoxy)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 71643354 |
| Molecular Formula | C10H16ClN3OS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-methylsulfanyl-4-(pyrrolidin-3-ylmethoxy)pyrimidine;hydrochloride |
| SMILES | CSc1nccc(OCC2CCNC2)n1.Cl |
| InChI | InChI=1S/C10H15N3OS.ClH/c1-15-10-12-5-3-9(13-10)14-7-8-2-4-11-6-8;/h3,5,8,11H,2,4,6-7H2,1H3;1H |
| InChIKey | YDOGRGLMCHFISK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |