C10H17ClN4S — CID 71643312
2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine;hydrochloride (PubChem CID 71643312) has the molecular formula C10H17ClN4S and a molecular weight of 260.79 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine;hydrochloride.
| Compound Name | 2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 71643312 |
| Molecular Formula | C10H17ClN4S |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine;hydrochloride |
| SMILES | CSc1nccc(N[C@@H]2CCCNC2)n1.Cl |
| InChI | InChI=1S/C10H16N4S.ClH/c1-15-10-12-6-4-9(14-10)13-8-3-2-5-11-7-8;/h4,6,8,11H,2-3,5,7H2,1H3,(H,12,13,14);1H/t8-;/m1./s1 |
| InChIKey | XLGIFZQYEWDHJE-DDWIOCJRSA-N |
| XLogP | 1.78 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |