C10H14ClN3 — CID 71564691
6-chloro-N-piperidin-3-ylpyridin-2-amine (PubChem CID 71564691) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 6-chloro-N-piperidin-3-ylpyridin-2-amine.
| Compound Name | 6-chloro-N-piperidin-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 71564691 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 6-chloro-N-piperidin-3-ylpyridin-2-amine |
| SMILES | Clc1cccc(NC2CCCNC2)n1 |
| InChI | InChI=1S/C10H14ClN3/c11-9-4-1-5-10(14-9)13-8-3-2-6-12-7-8/h1,4-5,8,12H,2-3,6-7H2,(H,13,14) |
| InChIKey | WPQLOCRGEHBSGP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|