C10H16N4S — CID 71643313
2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine (PubChem CID 71643313) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | 2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71643313 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-methylsulfanyl-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
| SMILES | CSc1nccc(N[C@@H]2CCCNC2)n1 |
| InChI | InChI=1S/C10H16N4S/c1-15-10-12-6-4-9(14-10)13-8-3-2-5-11-7-8/h4,6,8,11H,2-3,5,7H2,1H3,(H,12,13,14)/t8-/m1/s1 |
| InChIKey | FRNCBIFBZFYIDX-MRVPVSSYSA-N |
| XLogP | 1.36 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |