C11H18ClN3 — CID 71638526
4-methyl-N-[(3R)-piperidin-3-yl]pyridin-2-amine;hydrochloride (PubChem CID 71638526) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-methyl-N-[(3R)-piperidin-3-yl]pyridin-2-amine;hydrochloride.
| Compound Name | 4-methyl-N-[(3R)-piperidin-3-yl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71638526 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-methyl-N-[(3R)-piperidin-3-yl]pyridin-2-amine;hydrochloride |
| SMILES | Cc1ccnc(N[C@@H]2CCCNC2)c1.Cl |
| InChI | InChI=1S/C11H17N3.ClH/c1-9-4-6-13-11(7-9)14-10-3-2-5-12-8-10;/h4,6-7,10,12H,2-3,5,8H2,1H3,(H,13,14);1H/t10-;/m1./s1 |
| InChIKey | VLNKFZWQAGEFCG-HNCPQSOCSA-N |
| XLogP | 1.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |