C11H18N2 — CID 170575903
N-cyclopropyl-4-methylpyridin-2-amine;ethane (PubChem CID 170575903) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-cyclopropyl-4-methylpyridin-2-amine;ethane.
| Compound Name | N-cyclopropyl-4-methylpyridin-2-amine;ethane |
|---|---|
| PubChem CID | 170575903 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-cyclopropyl-4-methylpyridin-2-amine;ethane |
| SMILES | CC.Cc1ccnc(NC2CC2)c1 |
| InChI | InChI=1S/C9H12N2.C2H6/c1-7-4-5-10-9(6-7)11-8-2-3-8;1-2/h4-6,8H,2-3H2,1H3,(H,10,11);1-2H3 |
| InChIKey | DOXIWQJNNSNPBT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |